|
CAS#: 70389-17-2 Product: 6-Methyl-16-Azatricyclo(9.2.2.14,8)Hexadeca-2,4,6,8(16),9,11,13,14-Octaene No suppilers available for the product. |
| Name | 6-Methyl-16-Azatricyclo(9.2.2.14,8)Hexadeca-2,4,6,8(16),9,11,13,14-Octaene |
|---|---|
| Synonyms | 16-Azatricyclo(9.2.2.14,8)Hexadeca-2,4,6,8(16),9,11,13,14-Octaene, 6-Methyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C16H13N |
| Molecular Weight | 219.29 |
| CAS Registry Number | 70389-17-2 |
| SMILES | N1=C\2C=C(C=C1\C=C/C3=CC=C(\C=C2)C=C3)C |
| InChI | 1S/C16H13N/c1-12-10-15-8-6-13-2-3-14(5-4-13)7-9-16(11-12)17-15/h2-11H,1H3/b8-6-,9-7- |
| InChIKey | LTHSBNOMWXMUBF-VRHVFUOLSA-N |
| Density | 1.11g/cm3 (Cal.) |
|---|---|
| Boiling point | 387.296°C at 760 mmHg (Cal.) |
| Flash point | 172.175°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Methyl-16-Azatricyclo(9.2.2.14,8)Hexadeca-2,4,6,8(16),9,11,13,14-Octaene |