|
CAS#: 70445-88-4 Product: 2,3-Dimethylbenzothiophene Sulfoxide No suppilers available for the product. |
| Name | 2,3-Dimethylbenzothiophene Sulfoxide |
|---|---|
| Synonyms | Benzo[B]Thiophene, 2,3-Dimethyl-, 1-Oxide; 2,3-Dimethyl-1-Benzothiophene 1-Oxide; Inchi=1/C10h10os/C1-7-8(2)12(11)10-6-4-3-5-9(7)10/H3-6H,1-2H |
| Molecular Structure | ![]() |
| Molecular Formula | C10H10OS |
| Molecular Weight | 178.25 |
| CAS Registry Number | 70445-88-4 |
| SMILES | [S]1(=O)C2=C(C(=C1C)C)C=CC=C2 |
| InChI | 1S/C10H10OS/c1-7-8(2)12(11)10-6-4-3-5-9(7)10/h3-6H,1-2H3 |
| InChIKey | SYRBKZYSIYJRJM-UHFFFAOYSA-N |
| Density | 1.271g/cm3 (Cal.) |
|---|---|
| Boiling point | 372.417°C at 760 mmHg (Cal.) |
| Flash point | 179.032°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3-Dimethylbenzothiophene Sulfoxide |