|
CAS#: 7046-61-9 Product: (Nitroimino)Diethylenediisocyanate No suppilers available for the product. |
| Name | (Nitroimino)Diethylenediisocyanate |
|---|---|
| Synonyms | 3-Nitro-3-Azapentane-1,5-Diisocyanate; Brn 1965884; Ethanamine, 2-Isocyanato-N-(2-Isocyanatoethyl)-N-Nitro- |
| Molecular Structure | ![]() |
| Molecular Formula | C6H8N4O4 |
| Molecular Weight | 200.15 |
| CAS Registry Number | 7046-61-9 |
| SMILES | O=C=NCCN(CCN=C=O)[N+]([O-])=O |
| InChI | 1S/C6H8N4O4/c11-5-7-1-3-9(10(13)14)4-2-8-6-12/h1-4H2 |
| InChIKey | PMZAXZNFRDOMGE-UHFFFAOYSA-N |
| Density | 1.34g/cm3 (Cal.) |
|---|---|
| Boiling point | 380.487°C at 760 mmHg (Cal.) |
| Flash point | 183.912°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (Nitroimino)Diethylenediisocyanate |