|
CAS#: 70486-07-6 Product: 3-Chloro-4-(Diphenylamino)-6-Phenyl-Pyran-2-One No suppilers available for the product. |
| Name | 3-Chloro-4-(Diphenylamino)-6-Phenyl-Pyran-2-One |
|---|---|
| Synonyms | 3-Chloro-4-(Di(Phenyl)Amino)-6-Phenyl-Pyran-2-One; 3-Chloro-4-(Di(Phenyl)Amino)-6-Phenyl-2-Pyranone; Nsc315563 |
| Molecular Structure | ![]() |
| Molecular Formula | C23H16ClNO2 |
| Molecular Weight | 373.84 |
| CAS Registry Number | 70486-07-6 |
| SMILES | C1=C(C=CC=C1)C2=CC(=C(Cl)C(=O)O2)N(C3=CC=CC=C3)C4=CC=CC=C4 |
| InChI | 1S/C23H16ClNO2/c24-22-20(16-21(27-23(22)26)17-10-4-1-5-11-17)25(18-12-6-2-7-13-18)19-14-8-3-9-15-19/h1-16H |
| InChIKey | CQYOWWHYFRCCKZ-UHFFFAOYSA-N |
| Density | 1.336g/cm3 (Cal.) |
|---|---|
| Boiling point | 488.375°C at 760 mmHg (Cal.) |
| Flash point | 249.16°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Chloro-4-(Diphenylamino)-6-Phenyl-Pyran-2-One |