|
CAS#: 70556-52-4 Product: 2-Methyl-1-(4-Methyl-3-Cyclohexen-1-Yl)Pent-1-En-3-Ol No suppilers available for the product. |
| Name | 2-Methyl-1-(4-Methyl-3-Cyclohexen-1-Yl)Pent-1-En-3-Ol |
|---|---|
| Synonyms | 2-Methyl-1-(4-Methyl-3-Cyclohexen-1-Yl)Pent-1-En-3-Ol |
| Molecular Structure | ![]() |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 |
| CAS Registry Number | 70556-52-4 |
| EINECS | 274-669-4 |
| SMILES | C(C(O)C(=C/C1CC=C(CC1)C)/C)C |
| InChI | 1S/C13H22O/c1-4-13(14)11(3)9-12-7-5-10(2)6-8-12/h5,9,12-14H,4,6-8H2,1-3H3/b11-9+ |
| InChIKey | XZSMHQUHZREMCJ-PKNBQFBNSA-N |
| Density | 0.968g/cm3 (Cal.) |
|---|---|
| Boiling point | 287.342°C at 760 mmHg (Cal.) |
| Flash point | 109.345°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-1-(4-Methyl-3-Cyclohexen-1-Yl)Pent-1-En-3-Ol |