|
CAS#: 705948-99-8 Product: 2-Amino-2,6,6-trimethylbicyclo[3.1.1]heptane-3-carboxylic acid No suppilers available for the product. |
| Name | 2-Amino-2,6,6-trimethylbicyclo[3.1.1]heptane-3-carboxylic acid |
|---|---|
| Synonyms | 2-amino-2 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.27 |
| CAS Registry Number | 705948-99-8 |
| SMILES | CC1(C2CC(C(C1C2)(C)N)C(=O)O)C |
| InChI | 1S/C11H19NO2/c1-10(2)6-4-7(9(13)14)11(3,12)8(10)5-6/h6-8H,4-5,12H2,1-3H3,(H,13,14) |
| InChIKey | RVNVDAUGIAPWLP-UHFFFAOYSA-N |
| Density | 1.085g/cm3 (Cal.) |
|---|---|
| Boiling point | 303.506°C at 760 mmHg (Cal.) |
| Flash point | 137.356°C (Cal.) |
| Refractive index | 1.505 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Amino-2,6,6-trimethylbicyclo[3.1.1]heptane-3-carboxylic acid |