|
CAS#: 7061-81-6 Product: 2,4,7-Trichlorofluorene No suppilers available for the product. |
| Name | 2,4,7-Trichlorofluorene |
|---|---|
| Synonyms | Nciopen2_003598; Nsc73078 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H7Cl3 |
| Molecular Weight | 269.56 |
| CAS Registry Number | 7061-81-6 |
| SMILES | C1=CC(=CC3=C1C2=C(C=C(C=C2C3)Cl)Cl)Cl |
| InChI | 1S/C13H7Cl3/c14-9-1-2-11-7(4-9)3-8-5-10(15)6-12(16)13(8)11/h1-2,4-6H,3H2 |
| InChIKey | MXDREDYHROHHGJ-UHFFFAOYSA-N |
| Density | 1.463g/cm3 (Cal.) |
|---|---|
| Boiling point | 405.262°C at 760 mmHg (Cal.) |
| Flash point | 284.99°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4,7-Trichlorofluorene |