|
CAS#: 70648-25-8 Product: 1,2,3,4,6,7,9-HeptachloroDibenzofuran No suppilers available for the product. |
| Name | 1,2,3,4,6,7,9-HeptachloroDibenzofuran |
|---|---|
| Synonyms | Dibenzofuran,1,2,3,4,6,7,9-Heptachloro; Dibenzofuran, 1,2,3,4,6,7,9-Heptachloro- |
| Molecular Structure | ![]() |
| Molecular Formula | C12HCl7O |
| Molecular Weight | 409.31 |
| CAS Registry Number | 70648-25-8 |
| SMILES | C1=C(C(=C3C(=C1Cl)C2=C(C(=C(C(=C2Cl)Cl)Cl)Cl)O3)Cl)Cl |
| InChI | 1S/C12HCl7O/c13-2-1-3(14)6(15)11-4(2)5-7(16)8(17)9(18)10(19)12(5)20-11/h1H |
| InChIKey | JWXWOEUKHXOUSK-UHFFFAOYSA-N |
| Density | 1.826g/cm3 (Cal.) |
|---|---|
| Boiling point | 498.356°C at 760 mmHg (Cal.) |
| Flash point | 255.197°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3,4,6,7,9-HeptachloroDibenzofuran |