|
CAS#: 707-55-1 Product: 1,1,2,3,4,5,6-Heptachlorocyclohexane No suppilers available for the product. |
| Name | 1,1,2,3,4,5,6-Heptachlorocyclohexane |
|---|---|
| Synonyms | Cyclohexane, 1,1,2,3,4,5,6-Heptachloro-; Cyclohexane, Heptachloro- |
| Molecular Structure | ![]() |
| Molecular Formula | C6H5Cl7 |
| Molecular Weight | 325.28 |
| CAS Registry Number | 707-55-1 |
| EINECS | 211-899-6 |
| SMILES | C1(C(C(C(Cl)C(C1Cl)Cl)Cl)(Cl)Cl)Cl |
| InChI | 1S/C6H5Cl7/c7-1-2(8)4(10)6(12,13)5(11)3(1)9/h1-5H |
| InChIKey | DWMMFAQCEHVJPE-UHFFFAOYSA-N |
| Density | 1.677g/cm3 (Cal.) |
|---|---|
| Boiling point | 326.477°C at 760 mmHg (Cal.) |
| Flash point | 151.448°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1,2,3,4,5,6-Heptachlorocyclohexane |