|
CAS#: 70703-38-7 Product: 5,5'-Methylenebis(1,3-Phenylenediamine) No suppilers available for the product. |
| Name | 5,5'-Methylenebis(1,3-Phenylenediamine) |
|---|---|
| Synonyms | [3-Amino-5-(3,5-Diaminobenzyl)Phenyl]Amine; 1,3-Benzenediamine, 5,5'-Methylenebis-; 3,3',5,5'-Tetraaminodiphenylmethane |
| Molecular Structure | ![]() |
| Molecular Formula | C13H16N4 |
| Molecular Weight | 228.30 |
| CAS Registry Number | 70703-38-7 |
| SMILES | C1=C(C=C(C=C1N)CC2=CC(=CC(=C2)N)N)N |
| InChI | 1S/C13H16N4/c14-10-2-8(3-11(15)6-10)1-9-4-12(16)7-13(17)5-9/h2-7H,1,14-17H2 |
| InChIKey | OZQFIEUIUYZRSI-UHFFFAOYSA-N |
| Density | 1.283g/cm3 (Cal.) |
|---|---|
| Boiling point | 546.118°C at 760 mmHg (Cal.) |
| Flash point | 329.573°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,5'-Methylenebis(1,3-Phenylenediamine) |