|
CAS#: 70730-48-2 Product: 4-Methyl-N-(7-nitro-9H-fluoren-2-yl)benzenesulfonamide No suppilers available for the product. |
| Name | 4-Methyl-N-(7-nitro-9H-fluoren-2-yl)benzenesulfonamide |
|---|---|
| Synonyms | Nsc141064 |
| Molecular Structure | ![]() |
| Molecular Formula | C20H16N2O4S |
| Molecular Weight | 380.42 |
| CAS Registry Number | 70730-48-2 |
| SMILES | C1=CC(=CC=C1[S](=O)(NC4=CC2=C(C3=C(C2)C=C([N+]([O-])=O)C=C3)C=C4)=O)C |
| InChI | 1S/C20H16N2O4S/c1-13-2-6-18(7-3-13)27(25,26)21-16-4-8-19-14(11-16)10-15-12-17(22(23)24)5-9-20(15)19/h2-9,11-12,21H,10H2,1H3 |
| InChIKey | FKPSYOXIVPSXKF-UHFFFAOYSA-N |
| Density | 1.432g/cm3 (Cal.) |
|---|---|
| Boiling point | 587.94°C at 760 mmHg (Cal.) |
| Flash point | 309.375°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Methyl-N-(7-nitro-9H-fluoren-2-yl)benzenesulfonamide |