|
CAS#: 70766-54-0 Product: 4,6-Di-Tert-Butyl-2,3-Xylenol No suppilers available for the product. |
| Name | 4,6-Di-Tert-Butyl-2,3-Xylenol |
|---|---|
| Synonyms | 4,6-Ditert-Butyl-2,3-Dimethyl-Phenol; Phenol, 4,6-Bis(1,1-Dimethylethyl)-2,3-Dimethyl-; 2,3-Dimethyl-4,6-Di-Tert-Butylphenol |
| Molecular Structure | ![]() |
| Molecular Formula | C16H26O |
| Molecular Weight | 234.38 |
| CAS Registry Number | 70766-54-0 |
| EINECS | 274-857-6 |
| SMILES | C1=C(C(=C(C(=C1C(C)(C)C)O)C)C)C(C)(C)C |
| InChI | 1S/C16H26O/c1-10-11(2)14(17)13(16(6,7)8)9-12(10)15(3,4)5/h9,17H,1-8H3 |
| InChIKey | YYJBEOVFNCROQM-UHFFFAOYSA-N |
| Density | 0.924g/cm3 (Cal.) |
|---|---|
| Boiling point | 283.999°C at 760 mmHg (Cal.) |
| Flash point | 132.589°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,6-Di-Tert-Butyl-2,3-Xylenol |