Online Database of Chemicals from Around the World
|
CAS#: 70784-98-4 Product: 2-(p-Methoxyphenyl)Vinylmethylsulfone No suppilers available for the product. |
| Name | 2-(p-Methoxyphenyl)Vinylmethylsulfone |
|---|---|
| Synonyms | 1-Methoxy-4-[(E)-2-Methylsulfonylvinyl]Benzene; 1-[(E)-2-Mesylvinyl]-4-Methoxy-Benzene; Benzene, 1-Methoxy-4-[2-(Methylsulfonyl)Ethenyl]- |
| Molecular Structure |  |
| Molecular Formula | C10H12O3S |
| Molecular Weight | 212.26 |
| CAS Registry Number | 70784-98-4 |
| SMILES | C1=C(\C=C\[S](=O)(=O)C)C=CC(=C1)OC |
| InChI | 1S/C10H12O3S/c1-13-10-5-3-9(4-6-10)7-8-14(2,11)12/h3-8H,1-2H3/b8-7+ |
| InChIKey | ASRRXCMJEGWVQS-BQYQJAHWSA-N |
| Density | 1.21g/cm3 (Cal.) |
|---|---|
| Boiling point | 421.39°C at 760 mmHg (Cal.) |
| Flash point | 208.649°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(p-Methoxyphenyl)Vinylmethylsulfone |