|
CAS#: 70788-54-4 Product: 2,3,4-Trichloro-6-(Trichloromethyl)Pyridine No suppilers available for the product. |
| Name | 2,3,4-Trichloro-6-(Trichloromethyl)Pyridine |
|---|---|
| Synonyms | Pyridine, 2,3,4-Trichloro-6-(Trichloromethyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C6HCl6N |
| Molecular Weight | 299.80 |
| CAS Registry Number | 70788-54-4 |
| SMILES | C1=C(C(=C(Cl)N=C1C(Cl)(Cl)Cl)Cl)Cl |
| InChI | 1S/C6HCl6N/c7-2-1-3(6(10,11)12)13-5(9)4(2)8/h1H |
| InChIKey | QDOUCCJYFGZABY-UHFFFAOYSA-N |
| Density | 1.765g/cm3 (Cal.) |
|---|---|
| Boiling point | 296.19°C at 760 mmHg (Cal.) |
| Flash point | 160.978°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3,4-Trichloro-6-(Trichloromethyl)Pyridine |