|
CAS#: 708-18-9 Product: Tecostanine No suppilers available for the product. |
| Name | Tecostanine |
|---|---|
| Synonyms | (2,7-Dimethyl-1,3,4,4A,5,6,7,7A-Octahydro-2-Pyrindin-4-Yl)Methanol; C09989; Tecostanine |
| Molecular Structure | ![]() |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 |
| CAS Registry Number | 708-18-9 |
| SMILES | C(C1C2C(CN(C1)C)C(C)CC2)O |
| InChI | 1S/C11H21NO/c1-8-3-4-10-9(7-13)5-12(2)6-11(8)10/h8-11,13H,3-7H2,1-2H3 |
| InChIKey | CRVXJVHSLVEDRI-UHFFFAOYSA-N |
| Density | 0.963g/cm3 (Cal.) |
|---|---|
| Boiling point | 245.313°C at 760 mmHg (Cal.) |
| Flash point | 89.408°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Tecostanine |