|
CAS#: 7088-10-0 Product: 3,4,7,8,9,9a-Hexahydro-9a-Phenyl-2H,6H-Pyrido[2,1-b][1,3]Oxazin-6-One No suppilers available for the product. |
| Name | 3,4,7,8,9,9a-Hexahydro-9a-Phenyl-2H,6H-Pyrido[2,1-b][1,3]Oxazin-6-One |
|---|---|
| Synonyms | 2H,6H-Pyrido(2,1-B)(1,3)Oxazin-6-One, 3,4,7,8,9,9A-Hexahydro-9A-Phenyl-; 3,4,7,8,9,9A-Hexahydro-9A-Phenyl-2H,6H-Pyrido(2,1-B)(1,3)Oxazin-6-One; Brn 1217439 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.29 |
| CAS Registry Number | 7088-10-0 |
| SMILES | C3=C(C12N(C(CCC1)=O)CCCO2)C=CC=C3 |
| InChI | 1S/C14H17NO2/c16-13-8-4-9-14(12-6-2-1-3-7-12)15(13)10-5-11-17-14/h1-3,6-7H,4-5,8-11H2 |
| InChIKey | JAYUUVKVDZGYBL-UHFFFAOYSA-N |
| Density | 1.191g/cm3 (Cal.) |
|---|---|
| Boiling point | 399.215°C at 760 mmHg (Cal.) |
| Flash point | 195.238°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,4,7,8,9,9a-Hexahydro-9a-Phenyl-2H,6H-Pyrido[2,1-b][1,3]Oxazin-6-One |