|
CAS#: 7090-25-7 Product: Nitrosocarbaryl No suppilers available for the product. |
| Name | Nitrosocarbaryl |
|---|---|
| Synonyms | 1-Naphthyl N-Methyl-N-Nitroso-Carbamate; N-Methyl-N-Nitrosocarbamic Acid 1-Naphthyl Ester; N-Methyl-N-Nitroso-Carbamic Acid 1-Naphthyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C12H10N2O3 |
| Molecular Weight | 230.22 |
| CAS Registry Number | 7090-25-7 |
| SMILES | C1=CC2=C(C=C1)C(=CC=C2)OC(=O)N(N=O)C |
| InChI | 1S/C12H10N2O3/c1-14(13-16)12(15)17-11-8-4-6-9-5-2-3-7-10(9)11/h2-8H,1H3 |
| InChIKey | FFSXTYIBUNXZMF-UHFFFAOYSA-N |
| Density | 1.248g/cm3 (Cal.) |
|---|---|
| Boiling point | 352.028°C at 760 mmHg (Cal.) |
| Flash point | 166.701°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Nitrosocarbaryl |