|
CAS#: 7096-96-0 Product: Gelsedine No suppilers available for the product. |
| Name | Gelsedine |
|---|---|
| Synonyms | {Spiro[3H-Indole-3,7'(6'H)-[3,} {6]Methano[1H]Oxepino[4,3-B]Pyrrol]-2(1H)-One,} 2'-Ethyl-2',3',3'A, 4',8',8'A-Hexahydro-1-Methoxy-, {[2'R-(2'.Alpha.,3'.Alpha.,} 3'A.Beta.,6'.Alpha.,7'.Alpha.,8'A.Beta.)]-; Gelsedine; Nsc71050 |
| Molecular Structure | ![]() |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 |
| CAS Registry Number | 7096-96-0 |
| SMILES | C5=C4C3(C2OCC1C(NC(C1C2)CC)C3)C(=O)N(OC)C4=CC=C5 |
| InChI | 1S/C19H24N2O3/c1-3-14-11-8-17-19(9-15(20-14)12(11)10-24-17)13-6-4-5-7-16(13)21(23-2)18(19)22/h4-7,11-12,14-15,17,20H,3,8-10H2,1-2H3 |
| InChIKey | LDBVYQSHIPCQPT-UHFFFAOYSA-N |
| Density | 1.292g/cm3 (Cal.) |
|---|---|
| Boiling point | 462.228°C at 760 mmHg (Cal.) |
| Flash point | 233.347°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Gelsedine |