|
CAS#: 71018-72-9 Product: 5-Cyclohexyl-1-(2,4-dimethylphenyl)-3-methyl-1,3,5-triazinane-2-thione No suppilers available for the product. |
| Name | 5-Cyclohexyl-1-(2,4-dimethylphenyl)-3-methyl-1,3,5-triazinane-2-thione |
|---|---|
| Synonyms | 5-(cycloh |
| Molecular Structure | ![]() |
| Molecular Formula | C18H27N3S |
| Molecular Weight | 317.49 |
| CAS Registry Number | 71018-72-9 |
| EINECS | 275-130-6 |
| SMILES | Cc1ccc(c(c1)C)N2CN(CN(C2=S)C)C3CCCCC3 |
| InChI | 1S/C18H27N3S/c1-14-9-10-17(15(2)11-14)21-13-20(12-19(3)18(21)22)16-7-5-4-6-8-16/h9-11,16H,4-8,12-13H2,1-3H3 |
| InChIKey | YGDSKCANUVHVRV-UHFFFAOYSA-N |
| Density | 1.161g/cm3 (Cal.) |
|---|---|
| Boiling point | 497.911°C at 760 mmHg (Cal.) |
| Flash point | 254.928°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Cyclohexyl-1-(2,4-dimethylphenyl)-3-methyl-1,3,5-triazinane-2-thione |