|
CAS#: 7104-26-9 Product: Securinine No suppilers available for the product. |
| Name | Securinine |
|---|---|
| Synonyms | Securinine Mononitrate; Securinine, Nitrate |
| Molecular Structure | ![]() |
| Molecular Formula | C13H16N2O5 |
| Molecular Weight | 280.28 |
| CAS Registry Number | 7104-26-9 |
| SMILES | [C@H]14N([C@@H]3CC12OC(=O)C=C2C=C3)CCCC4.O=[N+]([O-])O |
| InChI | 1S/C13H15NO2.HNO3/c15-12-7-9-4-5-10-8-13(9,16-12)11-3-1-2-6-14(10)11;2-1(3)4/h4-5,7,10-11H,1-3,6,8H2;(H,2,3,4)/t10-,11+,13?;/m0./s1 |
| InChIKey | GTMBYDCKQUSFCT-DGKOSOBHSA-N |
| Boiling point | 459°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 197°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Securinine |