|
CAS#: 711-62-6 Product: 4,5,6,7-Tetrachloro-1,3-benzodioxol-2-one No suppilers available for the product. |
| Name | 4,5,6,7-Tetrachloro-1,3-benzodioxol-2-one |
|---|---|
| Synonyms | 4,5,6,7-Tetrachloro-1,3-benzodioxol-2-one #; Carbonic acid, cyclic 3,4,5,6-tetrachloro-o-phenylene ester |
| Molecular Structure | ![]() |
| Molecular Formula | C7Cl4O3 |
| Molecular Weight | 273.89 |
| CAS Registry Number | 711-62-6 |
| SMILES | Clc2c1OC(=O)Oc1c(Cl)c(Cl)c2Cl |
| InChI | 1S/C7Cl4O3/c8-1-2(9)4(11)6-5(3(1)10)13-7(12)14-6 |
| InChIKey | PFAIWLKEOKSYGN-UHFFFAOYSA-N |
| Density | 1.89g/cm3 (Cal.) |
|---|---|
| Boiling point | 337.677°C at 760 mmHg (Cal.) |
| Flash point | 152.401°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,5,6,7-Tetrachloro-1,3-benzodioxol-2-one |