|
CAS#: 71130-56-8 Product: N-Methyl-2-(Methylamino)-5-Nitrobenzenemethanamine No suppilers available for the product. |
| Name | N-Methyl-2-(Methylamino)-5-Nitrobenzenemethanamine |
|---|---|
| Synonyms | N-Methyl-2-(Methylaminomethyl)-4-Nitro-Aniline; Methyl-(2-Methylamino-5-Nitro-Benzyl)Amine; Benzenemethanamine, N-Methyl-2-(Methylamino)-5-Nitro- |
| Molecular Structure | ![]() |
| Molecular Formula | C9H13N3O2 |
| Molecular Weight | 195.22 |
| CAS Registry Number | 71130-56-8 |
| SMILES | C1=C(C=C(C(=C1)NC)CNC)[N+]([O-])=O |
| InChI | 1S/C9H13N3O2/c1-10-6-7-5-8(12(13)14)3-4-9(7)11-2/h3-5,10-11H,6H2,1-2H3 |
| InChIKey | NRCUPURCPYSONN-UHFFFAOYSA-N |
| Density | 1.202g/cm3 (Cal.) |
|---|---|
| Boiling point | 353.532°C at 760 mmHg (Cal.) |
| Flash point | 167.61°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Methyl-2-(Methylamino)-5-Nitrobenzenemethanamine |