|
CAS#: 71157-73-8 Product: (R*,S*)-alpha-(3-Methoxyphenyl)-1-Methyl-2-Pyrrolidineethanol Acetate (Ester) No suppilers available for the product. |
| Name | (R*,S*)-alpha-(3-Methoxyphenyl)-1-Methyl-2-Pyrrolidineethanol Acetate (Ester) |
|---|---|
| Synonyms | Acetic Acid [(1R)-1-(3-Methoxyphenyl)-2-[(2S)-1-Methyl-2-Pyrrolidinyl]Ethyl] Ester; Acetic Acid [(1R)-1-(3-Methoxyphenyl)-2-[(2S)-1-Methylpyrrolidin-2-Yl]Ethyl] Ester; [(1R)-1-(3-Methoxyphenyl)-2-[(2S)-1-Methylpyrrolidin-2-Yl]Ethyl] Ethanoate |
| Molecular Structure | ![]() |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 |
| CAS Registry Number | 71157-73-8 |
| SMILES | [C@@H]1(N(CCC1)C)C[C@@H](OC(C)=O)C2=CC=CC(=C2)OC |
| InChI | 1S/C16H23NO3/c1-12(18)20-16(11-14-7-5-9-17(14)2)13-6-4-8-15(10-13)19-3/h4,6,8,10,14,16H,5,7,9,11H2,1-3H3/t14-,16+/m0/s1 |
| InChIKey | KBSXWGAHGUUBFZ-GOEBONIOSA-N |
| Density | 1.07g/cm3 (Cal.) |
|---|---|
| Boiling point | 362.102°C at 760 mmHg (Cal.) |
| Flash point | 172.793°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (R*,S*)-alpha-(3-Methoxyphenyl)-1-Methyl-2-Pyrrolidineethanol Acetate (Ester) |