|
CAS#: 71172-53-7 Product: 2,5-Dimethyl-2-Hexene-1,6-Diol Diacetate No suppilers available for the product. |
| Name | 2,5-Dimethyl-2-Hexene-1,6-Diol Diacetate |
|---|---|
| Synonyms | [(Z)-6-Acetoxy-2,5-Dimethyl-Hex-2-Enyl] Acetate; Acetic Acid [(Z)-6-Acetoxy-2,5-Dimethylhex-2-Enyl] Ester; Acetic Acid [(Z)-6-Acetoxy-2,5-Dimethyl-Hex-2-Enyl] Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 |
| CAS Registry Number | 71172-53-7 |
| SMILES | C(OC(=O)C)\C(C)=C/CC(C)COC(=O)C |
| InChI | 1S/C12H20O4/c1-9(7-15-11(3)13)5-6-10(2)8-16-12(4)14/h5,10H,6-8H2,1-4H3/b9-5- |
| InChIKey | WJQFKEKGHLXYOP-UITAMQMPSA-N |
| Density | 1.004g/cm3 (Cal.) |
|---|---|
| Boiling point | 284.703°C at 760 mmHg (Cal.) |
| Flash point | 130.62°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2,5-Dimethyl-2-Hexene-1,6-Diol Diacetate |