|
CAS#: 71173-52-9 Product: 1,2,3,4-Tetrahydro-6,7-Dimethyl-4a,9a-Epoxyanthracene-9,10-Dione No suppilers available for the product. |
| Name | 1,2,3,4-Tetrahydro-6,7-Dimethyl-4a,9a-Epoxyanthracene-9,10-Dione |
|---|---|
| Synonyms | 4A,9A-Epoxyanthracene-9,10-Dione, 1,2,3,4-Tetrahydro-6,7-Dimethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.30 |
| CAS Registry Number | 71173-52-9 |
| SMILES | C1=C2C(=CC(=C1C)C)C(C34C(C2=O)(O3)CCCC4)=O |
| InChI | 1S/C16H16O3/c1-9-7-11-12(8-10(9)2)14(18)16-6-4-3-5-15(16,19-16)13(11)17/h7-8H,3-6H2,1-2H3 |
| InChIKey | OJNNGLAQBNGNSK-UHFFFAOYSA-N |
| Density | 1.298g/cm3 (Cal.) |
|---|---|
| Boiling point | 467.157°C at 760 mmHg (Cal.) |
| Flash point | 210.645°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3,4-Tetrahydro-6,7-Dimethyl-4a,9a-Epoxyanthracene-9,10-Dione |