|
CAS#: 712-91-4 Product: Carbamic Acid o-Chloro-alpha-Methylphenethyl Ester No suppilers available for the product. |
| Name | Carbamic Acid o-Chloro-alpha-Methylphenethyl Ester |
|---|---|
| Synonyms | [2-(2-Chlorophenyl)-1-Methyl-Ethyl] Carbamate; Carbamic Acid [2-(2-Chlorophenyl)-1-Methylethyl] Ester; Carbamic Acid [2-(2-Chlorophenyl)-1-Methyl-Ethyl] Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C10H12ClNO2 |
| Molecular Weight | 213.66 |
| CAS Registry Number | 712-91-4 |
| SMILES | C1=C(C(=CC=C1)Cl)CC(OC(N)=O)C |
| InChI | 1S/C10H12ClNO2/c1-7(14-10(12)13)6-8-4-2-3-5-9(8)11/h2-5,7H,6H2,1H3,(H2,12,13) |
| InChIKey | JHZISMYMEAAHJP-UHFFFAOYSA-N |
| Density | 1.223g/cm3 (Cal.) |
|---|---|
| Boiling point | 367.891°C at 760 mmHg (Cal.) |
| Flash point | 176.294°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Carbamic Acid o-Chloro-alpha-Methylphenethyl Ester |