|
CAS#: 71201-33-7 Product: 7-Propyltheophylline Dopamine No suppilers available for the product. |
| Name | 7-Propyltheophylline Dopamine |
|---|---|
| Synonyms | 7-[3-[2-(3,4-Dihydroxyphenyl)Ethylamino]Propyl]-1,3-Dimethyl-Purine-2,6-Dione; 7-[3-[2-(3,4-Dihydroxyphenyl)Ethylamino]Propyl]-1,3-Dimethyl-Xanthine; 1H-Purine-2,6-Dione, 7-(3-((2-(3,4-Dihydroxyphenyl)Ethyl)Amino)Propyl)-3,7-Dihydro-1,3-Dimethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C18H23N5O4 |
| Molecular Weight | 373.41 |
| CAS Registry Number | 71201-33-7 |
| SMILES | C1=NC3=C([N]1CCCNCCC2=CC=C(O)C(=C2)O)C(=O)N(C(=O)N3C)C |
| InChI | 1S/C18H23N5O4/c1-21-16-15(17(26)22(2)18(21)27)23(11-20-16)9-3-7-19-8-6-12-4-5-13(24)14(25)10-12/h4-5,10-11,19,24-25H,3,6-9H2,1-2H3 |
| InChIKey | PTKBXZQSYDMMLK-UHFFFAOYSA-N |
| Density | 1.404g/cm3 (Cal.) |
|---|---|
| Boiling point | 671.232°C at 760 mmHg (Cal.) |
| Flash point | 359.748°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-Propyltheophylline Dopamine |