Online Database of Chemicals from Around the World
|
CAS#: 71215-87-7 Product: N-Methyl-2-[(Methylimino)Methyl]-4-Nitrobenzenamine No suppilers available for the product. |
| Name | N-Methyl-2-[(Methylimino)Methyl]-4-Nitrobenzenamine |
|---|---|
| Synonyms | N-Methyl-2-(Methyliminomethyl)-4-Nitro-Aniline; Methyl-[2-(Methyliminomethyl)-4-Nitro-Phenyl]Amine; Benzenamine, N-Methyl-2-((Methylimino)Methyl)-4-Nitro- |
| Molecular Structure | ![CAS#: 71215-87-7, N-Methyl-2-[(Methylimino)Methyl]-4-Nitrobenzenamine](/moreStructures/71215-87-7.gif) |
| Molecular Formula | C9H11N3O2 |
| Molecular Weight | 193.20 |
| CAS Registry Number | 71215-87-7 |
| SMILES | C1=C(C=C(C(=C1)NC)C=NC)[N+]([O-])=O |
| InChI | 1S/C9H11N3O2/c1-10-6-7-5-8(12(13)14)3-4-9(7)11-2/h3-6,11H,1-2H3 |
| InChIKey | FJQAOWJWYLMEIH-UHFFFAOYSA-N |
| Density | 1.193g/cm3 (Cal.) |
|---|---|
| Boiling point | 350.892°C at 760 mmHg (Cal.) |
| Flash point | 166.014°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Methyl-2-[(Methylimino)Methyl]-4-Nitrobenzenamine |