|
CAS#: 71239-64-0 Product: Flustramine A No suppilers available for the product. |
| Name | Flustramine A |
|---|---|
| Synonyms | (3Ar,8Br)-6-Bromo-8B-(1,1-Dimethylprop-2-Enyl)-3-Methyl-4-(3-Methylbut-2-Enyl)-2,3A-Dihydro-1H-Pyrrolo[2,3-B]Indole; 6-Bromo-1-Methyl-3A-(1,1-Dimethyl-Allyl)-8-(3-Methyl-But-2-Enyl)-1,2,3,3A,8,8A-Hexahydro-Pyrrolo[2,3-B]Indole; 6-Bromo-3A-(1,1-Dimethyl-Allyl)-1-Methyl-8-(3-Methyl-But-2-Enyl)-1,2,3,3A,8,8A-Hexahydro-Pyrrolo[2,3-B]Indole |
| Molecular Structure | ![]() |
| Molecular Formula | C21H29BrN2 |
| Molecular Weight | 389.38 |
| CAS Registry Number | 71239-64-0 |
| SMILES | [C@]13([C@@H](N(C2=CC(=CC=C12)Br)CC=C(C)C)N(CC3)C)C(C=C)(C)C |
| InChI | 1S/C21H29BrN2/c1-7-20(4,5)21-11-13-23(6)19(21)24(12-10-15(2)3)18-14-16(22)8-9-17(18)21/h7-10,14,19H,1,11-13H2,2-6H3/t19-,21-/m1/s1 |
| InChIKey | AJYIZQUARKFPEC-TZIWHRDSSA-N |
| Density | 1.201g/cm3 (Cal.) |
|---|---|
| Boiling point | 438.356°C at 760 mmHg (Cal.) |
| Flash point | 218.91°C (Cal.) |
| (1) | Santosh Kumar Adla, Florenz Sasse, Gerhard Kelter, Heinz-Herbert Fiebig and Thomas Lindel. Doubly prenylated tryptamines: cytotoxicity, antimicrobial activity and cyclisation to the marine natural product flustramine A, Org. Biomol. Chem., 2013, 11, 6119. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Flustramine A |