Online Database of Chemicals from Around the World
|
CAS#: 7132-66-3 Product: 4,5-Dimethyl-9-Acridinamine No suppilers available for the product. |
| Name | 4,5-Dimethyl-9-Acridinamine |
|---|---|
| Synonyms | 4,5-Dimethyl-9-Acridinamine; (4,5-Dimethylacridin-9-Yl)Amine; 5-22-11-00101 (Beilstein Handbook Reference) |
| Molecular Structure |  |
| Molecular Formula | C15H14N2 |
| Molecular Weight | 222.29 |
| CAS Registry Number | 7132-66-3 |
| SMILES | C1=CC=C(C2=C1C(=C3C(=N2)C(=CC=C3)C)N)C |
| InChI | 1S/C15H14N2/c1-9-5-3-7-11-13(16)12-8-4-6-10(2)15(12)17-14(9)11/h3-8H,1-2H3,(H2,16,17) |
| InChIKey | HIMUQVQWNLSNKM-UHFFFAOYSA-N |
| Density | 1.197g/cm3 (Cal.) |
|---|---|
| Boiling point | 436.779°C at 760 mmHg (Cal.) |
| Flash point | 248.024°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,5-Dimethyl-9-Acridinamine |