|
CAS#: 71339-44-1 Product: methyl 8-hydroxy-2-methoxy-9-oxo-xanthene-1-carboxylate No suppilers available for the product. |
| Name | methyl 8-hydroxy-2-methoxy-9-oxo-xanthene-1-carboxylate |
|---|---|
| Synonyms | methyl 8-hydroxy-2-methoxy-9-oxo-xanthene-1-carboxylate; Mycoxanthone |
| Molecular Structure | ![]() |
| Molecular Formula | C16H12O6 |
| Molecular Weight | 300.26 |
| CAS Registry Number | 71339-44-1 |
| SMILES | COc1ccc2c(c1C(=O)OC)c(=O)c3c(cccc3o2)O |
| InChI | 1S/C16H12O6/c1-20-9-6-7-11-13(14(9)16(19)21-2)15(18)12-8(17)4-3-5-10(12)22-11/h3-7,17H,1-2H3 |
| InChIKey | MEQSKFCSGPLKKJ-UHFFFAOYSA-N |
| Density | 1.403g/cm3 (Cal.) |
|---|---|
| Boiling point | 509.147°C at 760 mmHg (Cal.) |
| Flash point | 192.849°C (Cal.) |
| (1) | Assante G. Mycochromone and mycoxanthone: Two new metabolites from Mycosphaerella rosigena, Phytochemistry, 1979 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for methyl 8-hydroxy-2-methoxy-9-oxo-xanthene-1-carboxylate |