|
CAS#: 71384-23-1 Product: Serratanine No suppilers available for the product. |
| Name | Serratanine |
|---|---|
| Synonyms | Serratanine; C09869 |
| Molecular Structure | ![]() |
| Molecular Formula | C30H49N3O |
| Molecular Weight | 467.74 |
| CAS Registry Number | 71384-23-1 |
| SMILES | [C@@H]12[C@H]6C[C@H](C[C@@H]1N(C[C@@H](C2)C3C(=N[C@@H](CC3)C[C@@H]5[C@H]4[C@H](N(CCC4)C(=O)C)C[C@H](C5)C)C6)C)C |
| InChI | 1S/C30H49N3O/c1-18-11-22-16-28-25(23-15-27(22)29(12-18)32(4)17-23)8-7-24(31-28)14-21-10-19(2)13-30-26(21)6-5-9-33(30)20(3)34/h18-19,21-27,29-30H,5-17H2,1-4H3/t18-,19+,21-,22+,23-,24+,25?,26+,27-,29+,30-/m1/s1 |
| InChIKey | ZGALAVFQYJOLRQ-NTFZZEKZSA-N |
| Density | 1.285g/cm3 (Cal.) |
|---|---|
| Boiling point | 592.284°C at 760 mmHg (Cal.) |
| Flash point | 312.002°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Serratanine |