|
CAS#: 714-64-7 Product: 4,4-Bis(trifluoromethyl)bicyclo[3.2.0]hepta-2,6-diene No suppilers available for the product. |
| Name | 4,4-Bis(trifluoromethyl)bicyclo[3.2.0]hepta-2,6-diene |
|---|---|
| Synonyms | 4,4-Bis(trifluoromethyl)bicyclo[3.2.0]hepta-2,6-diene # |
| Molecular Structure | ![]() |
| Molecular Formula | C9H6F6 |
| Molecular Weight | 228.13 |
| CAS Registry Number | 714-64-7 |
| SMILES | FC(F)(F)C2(/C=C\C1/C=C\C12)C(F)(F)F |
| InChI | 1S/C9H6F6/c10-8(11,12)7(9(13,14)15)4-3-5-1-2-6(5)7/h1-6H |
| InChIKey | IDDRYYAUVAHKLF-UHFFFAOYSA-N |
| Density | 1.459g/cm3 (Cal.) |
|---|---|
| Boiling point | 139.238°C at 760 mmHg (Cal.) |
| Flash point | 35.101°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,4-Bis(trifluoromethyl)bicyclo[3.2.0]hepta-2,6-diene |