|
CAS#: 714-87-4 Product: 3,9-Dichloro-2,4,8,10-Tetraoxa-3,9-Diphosphaspiro[5.5]Undecane 3,9-Dioxide No suppilers available for the product. |
| Name | 3,9-Dichloro-2,4,8,10-Tetraoxa-3,9-Diphosphaspiro[5.5]Undecane 3,9-Dioxide |
|---|---|
| Synonyms | 2,4,8,10-Tetraoxa-3,9-Diphosphaspiro(5.5)Undecane, 3,9-Dichloro-, 3,9-Dioxide; 3,9-Dichloro-2,4,8,10-Tetraoxa-3,9-Diphosphaspiro(5.5)Undecane 3,9-Dioxide |
| Molecular Structure | ![]() |
| Molecular Formula | C5H8Cl2O6P2 |
| Molecular Weight | 296.97 |
| CAS Registry Number | 714-87-4 |
| EINECS | 211-935-0 |
| SMILES | O=[P]2(OCC1(CO[P](=O)(OC1)Cl)CO2)Cl |
| InChI | 1S/C5H8Cl2O6P2/c6-14(8)10-1-5(2-11-14)3-12-15(7,9)13-4-5/h1-4H2 |
| InChIKey | OCSPARJUBMYNLY-UHFFFAOYSA-N |
| Density | 1.698g/cm3 (Cal.) |
|---|---|
| Boiling point | 276.22°C at 760 mmHg (Cal.) |
| Flash point | 143.325°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,9-Dichloro-2,4,8,10-Tetraoxa-3,9-Diphosphaspiro[5.5]Undecane 3,9-Dioxide |