|
CAS#: 71424-66-3 Product: 1,1abeta,4,5,7,8,9,9abeta-Octahydro-3-Hydroxy-1,1,2,5a-Tetramethyl-7-Methylene-6H-Cyclopropa[3,4]Cyclohepta[1,2-e]Indene-6-One No suppilers available for the product. |
| Name | 1,1abeta,4,5,7,8,9,9abeta-Octahydro-3-Hydroxy-1,1,2,5a-Tetramethyl-7-Methylene-6H-Cyclopropa[3,4]Cyclohepta[1,2-e]Indene-6-One |
|---|---|
| Synonyms | Ccris 1441; Jatropholone A |
| Molecular Structure | ![]() |
| Molecular Formula | C20H24O2 |
| Molecular Weight | 296.41 |
| CAS Registry Number | 71424-66-3 |
| SMILES | [C@H]4(C(C1=C(C(=C(C2=C1C(=C)CCC3C2C3(C)C)C)O)C4)=O)C |
| InChI | 1S/C20H24O2/c1-9-6-7-13-17(20(13,4)5)15-11(3)19(22)12-8-10(2)18(21)16(12)14(9)15/h10,13,17,22H,1,6-8H2,2-5H3/t10-,13?,17?/m0/s1 |
| InChIKey | BMHPRIPRPDSKRK-ITNLDZRZSA-N |
| Density | 1.174g/cm3 (Cal.) |
|---|---|
| Boiling point | 482.076°C at 760 mmHg (Cal.) |
| Flash point | 204.731°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1abeta,4,5,7,8,9,9abeta-Octahydro-3-Hydroxy-1,1,2,5a-Tetramethyl-7-Methylene-6H-Cyclopropa[3,4]Cyclohepta[1,2-e]Indene-6-One |