|
CAS#: 71456-94-5 Product: N-Phenyldithiocarbamic Acid Trimethylsilyl Ester No suppilers available for the product. |
| Name | N-Phenyldithiocarbamic Acid Trimethylsilyl Ester |
|---|---|
| Synonyms | (Phenylamino)Methanedithioic Acid Trimethylsilyl Ester; Carbanilic Acid, Dithio-, Trimethylsilyl Ester; Dithiocarbanilic Acid Trimethylsilyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C10H15NS2Si |
| Molecular Weight | 241.44 |
| CAS Registry Number | 71456-94-5 |
| SMILES | C1=CC=CC=C1NC(S[Si](C)(C)C)=S |
| InChI | 1S/C10H15NS2Si/c1-14(2,3)13-10(12)11-9-7-5-4-6-8-9/h4-8H,1-3H3,(H,11,12) |
| InChIKey | ZPYVNSRVLQUGSI-UHFFFAOYSA-N |
| Density | 1.133g/cm3 (Cal.) |
|---|---|
| Boiling point | 297.688°C at 760 mmHg (Cal.) |
| Flash point | 133.837°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Phenyldithiocarbamic Acid Trimethylsilyl Ester |