|
CAS#: 71463-59-7 Product: 2,6-Dichlorophenyl Valerate No suppilers available for the product. |
| Name | 2,6-Dichlorophenyl Valerate |
|---|---|
| Synonyms | Pentanoic Acid (2,6-Dichlorophenyl) Ester; Valeric Acid (2,6-Dichlorophenyl) Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C11H12Cl2O2 |
| Molecular Weight | 247.12 |
| CAS Registry Number | 71463-59-7 |
| EINECS | 275-498-8 |
| SMILES | C1=CC=C(Cl)C(=C1Cl)OC(=O)CCCC |
| InChI | 1S/C11H12Cl2O2/c1-2-3-7-10(14)15-11-8(12)5-4-6-9(11)13/h4-6H,2-3,7H2,1H3 |
| InChIKey | ISMFOXVVLSHSRJ-UHFFFAOYSA-N |
| Density | 1.233g/cm3 (Cal.) |
|---|---|
| Boiling point | 316.417°C at 760 mmHg (Cal.) |
| Flash point | 125.074°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,6-Dichlorophenyl Valerate |