|
CAS#: 71477-78-6 Product: alpha-Butyl-2,4-Dimethyl-3-Cyclohexene-1-Methanol No suppilers available for the product. |
| Name | alpha-Butyl-2,4-Dimethyl-3-Cyclohexene-1-Methanol |
|---|---|
| Synonyms | Alpha-Butyl-2,4-Dimethyl-3-Cyclohexene-1-Methanol; 3-Cyclohexene-1-Methanol, Alpha-Butyl-2,4-Dimethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C13H24O |
| Molecular Weight | 196.33 |
| CAS Registry Number | 71477-78-6 |
| SMILES | [C@H](O)([C@H]1[C@@H](C=C(CC1)C)C)CCCC |
| InChI | 1S/C13H24O/c1-4-5-6-13(14)12-8-7-10(2)9-11(12)3/h9,11-14H,4-8H2,1-3H3/t11-,12-,13-/m1/s1 |
| InChIKey | AIUPLWNFVHFDRR-JHJVBQTASA-N |
| Density | 0.891g/cm3 (Cal.) |
|---|---|
| Boiling point | 268.698°C at 760 mmHg (Cal.) |
| Flash point | 96.634°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for alpha-Butyl-2,4-Dimethyl-3-Cyclohexene-1-Methanol |