|
CAS#: 71486-51-6 Product: Methyl (2-carbamoylphenoxy)(2-furyl)acetate No suppilers available for the product. |
| Name | Methyl (2-carbamoylphenoxy)(2-furyl)acetate |
|---|---|
| Synonyms | methyl α-[2-(aminocarbonyl)phenoxy]furan-2-acetate |
| Molecular Structure | ![]() |
| Molecular Formula | C14H13NO5 |
| Molecular Weight | 275.26 |
| CAS Registry Number | 71486-51-6 |
| EINECS | 275-524-8 |
| SMILES | NC(=O)c2ccccc2OC(c1ccco1)C(=O)OC |
| InChI | 1S/C14H13NO5/c1-18-14(17)12(11-7-4-8-19-11)20-10-6-3-2-5-9(10)13(15)16/h2-8,12H,1H3,(H2,15,16) |
| InChIKey | NZGLPWKKPRXQTJ-UHFFFAOYSA-N |
| Density | 1.293g/cm3 (Cal.) |
|---|---|
| Boiling point | 411.308°C at 760 mmHg (Cal.) |
| Flash point | 202.552°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl (2-carbamoylphenoxy)(2-furyl)acetate |