|
CAS#: 71501-54-7 Product: 5-Chloro-2-Tolylbenzenesulphonamide No suppilers available for the product. |
| Name | 5-Chloro-2-Tolylbenzenesulphonamide |
|---|---|
| Synonyms | 5-Chloro-2-Tolylbenzenesulphonamide |
| Molecular Structure | ![]() |
| Molecular Formula | C13H12ClNO2S |
| Molecular Weight | 281.76 |
| CAS Registry Number | 71501-54-7 |
| EINECS | 275-582-4 |
| SMILES | C1=C(Cl)C=CC(=C1[S](=O)(=O)N)C2=C(C=CC=C2)C |
| InChI | 1S/C13H12ClNO2S/c1-9-4-2-3-5-11(9)12-7-6-10(14)8-13(12)18(15,16)17/h2-8H,1H3,(H2,15,16,17) |
| InChIKey | IFFLXLLAZLFSIA-UHFFFAOYSA-N |
| Density | 1.33g/cm3 (Cal.) |
|---|---|
| Boiling point | 459.204°C at 760 mmHg (Cal.) |
| Flash point | 231.518°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Chloro-2-Tolylbenzenesulphonamide |