|
CAS#: 7152-42-3 Product: 10-Phenyl-10H-Phenothiazine No suppilers available for the product. |
| Name | 10-Phenyl-10H-Phenothiazine |
|---|---|
| Synonyms | 10H-Phenothiazine, 10-Phenyl-; Nsc23181; Phenothiazine, 10-Phenyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C18H13NS |
| Molecular Weight | 275.37 |
| CAS Registry Number | 7152-42-3 |
| SMILES | C1=CC=CC3=C1N(C2=C(C=CC=C2)S3)C4=CC=CC=C4 |
| InChI | 1S/C18H13NS/c1-2-8-14(9-3-1)19-15-10-4-6-12-17(15)20-18-13-7-5-11-16(18)19/h1-13H |
| InChIKey | WSEFYHOJDVVORU-UHFFFAOYSA-N |
| Density | 1.247g/cm3 (Cal.) |
|---|---|
| Boiling point | 411.232°C at 760 mmHg (Cal.) |
| Flash point | 202.506°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 10-Phenyl-10H-Phenothiazine |