|
CAS#: 7154-11-2 Product: 3-Methyl-1-Phenyl-2-Pyridin-2-Yl-Butan-1-One No suppilers available for the product. |
| Name | 3-Methyl-1-Phenyl-2-Pyridin-2-Yl-Butan-1-One |
|---|---|
| Synonyms | 3-Methyl-1-Phenyl-2-(2-Pyridyl)Butan-1-One; 3-Methyl-1-Phenyl-2-Pyridin-2-Yl-Butan-1-One; Nsc42700 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H17NO |
| Molecular Weight | 239.32 |
| CAS Registry Number | 7154-11-2 |
| SMILES | C1=CC=CC=C1C(=O)C(C2=NC=CC=C2)C(C)C |
| InChI | 1S/C16H17NO/c1-12(2)15(14-10-6-7-11-17-14)16(18)13-8-4-3-5-9-13/h3-12,15H,1-2H3 |
| InChIKey | GOLAESQVRDHHNN-UHFFFAOYSA-N |
| Density | 1.061g/cm3 (Cal.) |
|---|---|
| Boiling point | 356.224°C at 760 mmHg (Cal.) |
| Flash point | 177.029°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Methyl-1-Phenyl-2-Pyridin-2-Yl-Butan-1-One |