|
CAS#: 71550-50-0 Product: 2,5-Dimethoxy-N,N-Dimethyl-4-Nitrobenzenamine No suppilers available for the product. |
| Name | 2,5-Dimethoxy-N,N-Dimethyl-4-Nitrobenzenamine |
|---|---|
| Synonyms | 2,5-Dimethoxy-N,N-Dimethyl-4-Nitro-Aniline; (2,5-Dimethoxy-4-Nitro-Phenyl)-Dimethyl-Amine; Benzenamine, 2,5-Dimethoxy-N,N-Dimethyl-4-Nitro- |
| Molecular Structure | ![]() |
| Molecular Formula | C10H14N2O4 |
| Molecular Weight | 226.23 |
| CAS Registry Number | 71550-50-0 |
| SMILES | C1=C(C(=CC(=C1OC)N(C)C)OC)[N+]([O-])=O |
| InChI | 1S/C10H14N2O4/c1-11(2)7-5-10(16-4)8(12(13)14)6-9(7)15-3/h5-6H,1-4H3 |
| InChIKey | JSOVAHGEPQCHNC-UHFFFAOYSA-N |
| Density | 1.208g/cm3 (Cal.) |
|---|---|
| Boiling point | 347.023°C at 760 mmHg (Cal.) |
| Flash point | 163.674°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,5-Dimethoxy-N,N-Dimethyl-4-Nitrobenzenamine |