|
CAS#: 71566-43-3 Product: [Chloro(Dimethylamino)Methyl]Phosphonic Acid No suppilers available for the product. |
| Name | [Chloro(Dimethylamino)Methyl]Phosphonic Acid |
|---|---|
| Synonyms | [(R)-Chloro-Dimethylamino-Methyl]Phosphonic Acid; ((Dimethylamino)Chloromethyl)Phosphonic Acid; Phosphonic Acid, (Chloro(Dimethylamino)Methyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C3H9ClNO3P |
| Molecular Weight | 173.54 |
| CAS Registry Number | 71566-43-3 |
| SMILES | [C@H](Cl)([P](=O)(O)O)N(C)C |
| InChI | 1S/C3H9ClNO3P/c1-5(2)3(4)9(6,7)8/h3H,1-2H3,(H2,6,7,8)/t3-/m1/s1 |
| InChIKey | HLXNGXGHLKWUNU-GSVOUGTGSA-N |
| Density | 1.493g/cm3 (Cal.) |
|---|---|
| Boiling point | 277.142°C at 760 mmHg (Cal.) |
| Flash point | 121.412°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [Chloro(Dimethylamino)Methyl]Phosphonic Acid |