|
CAS#: 71600-20-9 Product: 1,2,3,4,5,8-Hexahydro-4alpha,8alpha-(Methanothiomethano)Naphthalene 10-Oxide No suppilers available for the product. |
| Name | 1,2,3,4,5,8-Hexahydro-4alpha,8alpha-(Methanothiomethano)Naphthalene 10-Oxide |
|---|---|
| Synonyms | 4.Alpha.,8.Alpha.-(Methanothiomethano)Naphthalene,1,2,3,4,5,8-Hexahydro-10-Oxide |
| Molecular Structure | ![]() |
| Molecular Formula | C12H18OS |
| Molecular Weight | 210.33 |
| CAS Registry Number | 71600-20-9 |
| SMILES | O=[S]1CC23C(C1)(CC=CC2)CCCC3 |
| InChI | 1S/C12H18OS/c13-14-9-11-5-1-2-6-12(11,10-14)8-4-3-7-11/h1-2H,3-10H2 |
| InChIKey | UUQYOBCIFKDXNP-UHFFFAOYSA-N |
| Density | 1.201g/cm3 (Cal.) |
|---|---|
| Boiling point | 402.933°C at 760 mmHg (Cal.) |
| Flash point | 197.487°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3,4,5,8-Hexahydro-4alpha,8alpha-(Methanothiomethano)Naphthalene 10-Oxide |