|
CAS#: 71609-27-3 Product: N-Hydroxy-(1,1'-Biphenyl)-4,4'-Diamine Dihydrochloride No suppilers available for the product. |
| Name | N-Hydroxy-(1,1'-Biphenyl)-4,4'-Diamine Dihydrochloride |
|---|---|
| Synonyms | (1,1'-Biphenyl)-4,4'-Diamine, N-Hydroxy-; N-Hydroxy-(1,1'-Biphenyl)-4,4'-Diamine |
| Molecular Structure | ![]() |
| Molecular Formula | C12H12N2O |
| Molecular Weight | 200.24 |
| CAS Registry Number | 71609-27-3 |
| SMILES | C2=C(C1=CC=C(N)C=C1)C=CC(=C2)NO |
| InChI | 1S/C12H12N2O/c13-11-5-1-9(2-6-11)10-3-7-12(14-15)8-4-10/h1-8,14-15H,13H2 |
| InChIKey | VAINAOKETCVWJD-UHFFFAOYSA-N |
| Density | 1.272g/cm3 (Cal.) |
|---|---|
| Boiling point | 398.922°C at 760 mmHg (Cal.) |
| Flash point | 195.061°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Hydroxy-(1,1'-Biphenyl)-4,4'-Diamine Dihydrochloride |