|
CAS#: 71660-03-2 Product: 5-Isopropenyl-2-methylenecyclohexyl acetate No suppilers available for the product. |
| Name | 5-Isopropenyl-2-methylenecyclohexyl acetate |
|---|---|
| Synonyms | acetic acid p-mentha-1(7),8-dien-2-yl ester; Acetic acid, p-1(7),8-menthadien-2-yl ester |
| Molecular Structure | ![]() |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 |
| CAS Registry Number | 71660-03-2 |
| SMILES | O=C(OC1C(=C)\CCC(\C(=C)C)C1)C |
| InChI | 1S/C12H18O2/c1-8(2)11-6-5-9(3)12(7-11)14-10(4)13/h11-12H,1,3,5-7H2,2,4H3 |
| InChIKey | CCLNPVCMIJDJLR-UHFFFAOYSA-N |
| Density | 0.957g/cm3 (Cal.) |
|---|---|
| Boiling point | 243.927°C at 760 mmHg (Cal.) |
| 77-79°C (Expl.) | |
| Flash point | 92.686°C (Cal.) |
| Refractive index | 1.473-1.479 (Expl.) |
| Market Analysis Reports |
| List of Reports Available for 5-Isopropenyl-2-methylenecyclohexyl acetate |