Online Database of Chemicals from Around the World
|
CAS#: 71662-31-2 Product: 4-[(4-Hydroxyphenyl)Amino]-1-Naphthol No suppilers available for the product. |
| Name | 4-[(4-Hydroxyphenyl)Amino]-1-Naphthol |
|---|---|
| Synonyms | 4-[(4-Hydroxyphenyl)Amino]-1-Naphthalenol; 4-[(4-Hydroxyphenyl)Amino]-1-Naphthol; 4-((4-Hydroxyphenyl)Amino)-1-Naphthol |
| Molecular Structure | ![CAS#: 71662-31-2, 4-[(4-Hydroxyphenyl)Amino]-1-Naphthol](/moreStructures/71662-31-2.gif) |
| Molecular Formula | C16H13NO2 |
| Molecular Weight | 251.28 |
| CAS Registry Number | 71662-31-2 |
| EINECS | 275-797-3 |
| SMILES | C2=C(NC1=CC=C(O)C=C1)C3=C(C(=C2)O)C=CC=C3 |
| InChI | 1S/C16H13NO2/c18-12-7-5-11(6-8-12)17-15-9-10-16(19)14-4-2-1-3-13(14)15/h1-10,17-19H |
| InChIKey | JHZVBYOUVQPKER-UHFFFAOYSA-N |
| Density | 1.348g/cm3 (Cal.) |
|---|---|
| Boiling point | 427.956°C at 760 mmHg (Cal.) |
| Flash point | 163.301°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[(4-Hydroxyphenyl)Amino]-1-Naphthol |