|
CAS#: 71676-04-5 Product: 4-Amino-N-(2,5-Dichloropentyl)-5-(Ethylsulphonyl)-2-Methoxybenzamide No suppilers available for the product. |
| Name | 4-Amino-N-(2,5-Dichloropentyl)-5-(Ethylsulphonyl)-2-Methoxybenzamide |
|---|---|
| Synonyms | 4-Amino-N-(2,5-Dichloropentyl)-5-Ethylsulfonyl-2-Methoxy-Benzamide; 4-Amino-N-(2,5-Dichloropentyl)-5-(Ethylsulphonyl)-2-Methoxybenzamide |
| Molecular Structure | ![]() |
| Molecular Formula | C15H22Cl2N2O4S |
| Molecular Weight | 397.32 |
| CAS Registry Number | 71676-04-5 |
| EINECS | 275-835-9 |
| SMILES | C1=C(N)C(=CC(=C1OC)C(=O)NCC(Cl)CCCCl)[S](=O)(=O)CC |
| InChI | 1S/C15H22Cl2N2O4S/c1-3-24(21,22)14-7-11(13(23-2)8-12(14)18)15(20)19-9-10(17)5-4-6-16/h7-8,10H,3-6,9,18H2,1-2H3,(H,19,20) |
| InChIKey | PFXOJRCOFMOPTK-UHFFFAOYSA-N |
| Density | 1.309g/cm3 (Cal.) |
|---|---|
| Boiling point | 587.237°C at 760 mmHg (Cal.) |
| Flash point | 308.95°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Amino-N-(2,5-Dichloropentyl)-5-(Ethylsulphonyl)-2-Methoxybenzamide |