|
CAS#: 71699-35-9 Product: Sitophilure No suppilers available for the product. |
| Name | Sitophilure |
|---|---|
| Synonyms | (4S,5R)-5-Hydroxy-4-Methyl-Heptan-3-One; 3-Heptanone, 5-Hydroxy-4-Methyl-, (R*,S*)-; Sitophilure |
| Molecular Structure | ![]() |
| Molecular Formula | C8H16O2 |
| Molecular Weight | 144.21 |
| CAS Registry Number | 71699-35-9 |
| SMILES | [C@@H](C(=O)CC)([C@H](O)CC)C |
| InChI | 1S/C8H16O2/c1-4-7(9)6(3)8(10)5-2/h6-7,9H,4-5H2,1-3H3/t6-,7+/m0/s1 |
| InChIKey | GEZUGFBWAPDBGZ-NKWVEPMBSA-N |
| Density | 0.925g/cm3 (Cal.) |
|---|---|
| Boiling point | 219.478°C at 760 mmHg (Cal.) |
| Flash point | 88.02°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Sitophilure |